C19H16F4N2O3 — CID 9220533
(E)-3-(2-fluorophenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]prop-2-enamide (PubChem CID 9220533) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9220533 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]prop-2-enamide |
| SMILES | CN(CC(=O)Nc1ccc(OC(F)(F)F)cc1)C(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C19H16F4N2O3/c1-25(18(27)11-6-13-4-2-3-5-16(13)20)12-17(26)24-14-7-9-15(10-8-14)28-19(21,22)23/h2-11H,12H2,1H3,(H,24,26)/b11-6+ |
| InChIKey | KYBYODGHFZGFGQ-IZZDOVSWSA-N |
| XLogP | 3.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|