C19H18BrFN2O3 — CID 17440544
(E)-3-(5-bromo-2-fluorophenyl)-N-[2-(4-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 17440544) has the molecular formula C19H18BrFN2O3 and a molecular weight of 421.27 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[2-(4-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[2-(4-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 17440544 |
| Molecular Formula | C19H18BrFN2O3 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[2-(4-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(NC(=O)CN(C)C(=O)/C=C/c2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C19H18BrFN2O3/c1-23(12-18(24)22-15-5-7-16(26-2)8-6-15)19(25)10-3-13-11-14(20)4-9-17(13)21/h3-11H,12H2,1-2H3,(H,22,24)/b10-3+ |
| InChIKey | PFEHALSJJBHXHQ-XCVCLJGOSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|