C14H19FN4O3 — CID 9223796
2-[[2-(ethylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide (PubChem CID 9223796) has the molecular formula C14H19FN4O3 and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9223796 |
| Molecular Formula | C14H19FN4O3 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[[2-(ethylcarbamoylamino)-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN(C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H19FN4O3/c1-3-16-14(22)18-13(21)9-19(2)8-12(20)17-11-6-4-5-10(15)7-11/h4-7H,3,8-9H2,1-2H3,(H,17,20)(H2,16,18,21,22) |
| InChIKey | XJXQFRZNAUGQKR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |