C21H26FN3O2 — CID 9250691
2-[[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide (PubChem CID 9250691) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9250691 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-[[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl]-methylamino]-N-(3-fluorophenyl)acetamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)CN(C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C21H26FN3O2/c1-4-15(2)18-10-5-6-11-19(18)24-21(27)14-25(3)13-20(26)23-17-9-7-8-16(22)12-17/h5-12,15H,4,13-14H2,1-3H3,(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | DAISTGTYTIBDSK-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |