C21H20N2O3 — CID 9226822
1,3-dioxo-N-(3-propan-2-ylphenyl)-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 9226822) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1,3-dioxo-N-(3-propan-2-ylphenyl)-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-N-(3-propan-2-ylphenyl)-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 9226822 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1,3-dioxo-N-(3-propan-2-ylphenyl)-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Nc3cccc(C(C)C)c3)cc2C1=O |
| InChI | InChI=1S/C21H20N2O3/c1-4-10-23-20(25)17-9-8-15(12-18(17)21(23)26)19(24)22-16-7-5-6-14(11-16)13(2)3/h4-9,11-13H,1,10H2,2-3H3,(H,22,24) |
| InChIKey | QUPGEBUKROLVIS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|