C18H13FN2O3 — CID 4825553
N-(4-fluorophenyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 4825553) has the molecular formula C18H13FN2O3 and a molecular weight of 324.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 4825553 |
| Molecular Formula | C18H13FN2O3 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(4-fluorophenyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)Nc3ccc(F)cc3)cc2C1=O |
| InChI | InChI=1S/C18H13FN2O3/c1-2-9-21-17(23)14-8-3-11(10-15(14)18(21)24)16(22)20-13-6-4-12(19)5-7-13/h2-8,10H,1,9H2,(H,20,22) |
| InChIKey | ICIXLOJXOVOBHD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|