About [(3R)-non-1-en-3-yl] acetate
[(3R)-non-1-en-3-yl] acetate (PubChem CID 92281382) has the molecular formula C11H20O2
and a molecular weight of 184.27 g/mol. Its IUPAC name is [(3R)-non-1-en-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R)-non-1-en-3-yl] acetate |
| PubChem CID | 92281382 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | [(3R)-non-1-en-3-yl] acetate |
| SMILES | CCCCCC[C@H](C=C)OC(=O)C |
| InChI | InChI=1S/C11H20O2/c1-4-6-7-8-9-11(5-2)13-10(3)12/h5,11H,2,4,6-9H2,1,3H3/t11-/m0/s1 |
| InChIKey | PUWRLDPHAKKTKR-NSHDSACASA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | 152 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-non-1-en-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-non-1-en-3-yl] acetate?
The IUPAC name of [(3R)-non-1-en-3-yl] acetate (CID 92281382) is [(3R)-non-1-en-3-yl] acetate.
What is the SMILES notation for [(3R)-non-1-en-3-yl] acetate?
The canonical SMILES for [(3R)-non-1-en-3-yl] acetate is CCCCCC[C@H](C=C)OC(=O)C.
What is the InChIKey of [(3R)-non-1-en-3-yl] acetate?
The InChIKey is PUWRLDPHAKKTKR-NSHDSACASA-N. The full InChI is InChI=1S/C11H20O2/c1-4-6-7-8-9-11(5-2)13-10(3)12/h5,11H,2,4,6-9H2,1,3H3/t11-/m0/s1.
What are the key properties of [(3R)-non-1-en-3-yl] acetate?
[(3R)-non-1-en-3-yl] acetate has a molecular weight of 184.27 g/mol, XLogP of 3.70, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-non-1-en-3-yl] acetate is sourced from PubChem (CID 92281382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).