C21H25N3O3 — CID 9231603
4-methoxy-N-[(Z)-[(1S)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzamide (PubChem CID 9231603) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-methoxy-N-[(Z)-[(1S)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzamide.
| Compound Name | 4-methoxy-N-[(Z)-[(1S)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 9231603 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-methoxy-N-[(Z)-[(1S)-1-morpholin-4-yl-1-phenylpropan-2-ylidene]amino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C(/C)[C@H](c2ccccc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-16(22-23-21(25)18-8-10-19(26-2)11-9-18)20(17-6-4-3-5-7-17)24-12-14-27-15-13-24/h3-11,20H,12-15H2,1-2H3,(H,23,25)/b22-16-/t20-/m1/s1 |
| InChIKey | ZHAXQBMZPOSXTP-SUNMQZQPSA-N |
| XLogP | 2.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|