C19H26N2OS — CID 9234141
1-(4-butylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea (PubChem CID 9234141) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea |
|---|---|
| PubChem CID | 9234141 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)N[C@@H](C)CCc2ccco2)cc1 |
| InChI | InChI=1S/C19H26N2OS/c1-3-4-6-16-9-11-17(12-10-16)21-19(23)20-15(2)8-13-18-7-5-14-22-18/h5,7,9-12,14-15H,3-4,6,8,13H2,1-2H3,(H2,20,21,23)/t15-/m0/s1 |
| InChIKey | CIJRDJXNAVIVHW-HNNXBMFYSA-N |
| XLogP | 4.93 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|