C17H22N2OS — CID 9234062
1-(2,5-dimethylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea (PubChem CID 9234062) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea |
|---|---|
| PubChem CID | 9234062 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(2S)-4-(furan-2-yl)butan-2-yl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N[C@@H](C)CCc2ccco2)c1 |
| InChI | InChI=1S/C17H22N2OS/c1-12-6-7-13(2)16(11-12)19-17(21)18-14(3)8-9-15-5-4-10-20-15/h4-7,10-11,14H,8-9H2,1-3H3,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | WZUGPTRJOAEQIU-AWEZNQCLSA-N |
| XLogP | 4.20 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|