C19H18FN3O2 — CID 9235662
2-fluoro-N-[(Z)-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 9235662) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-fluoro-N-[(Z)-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 2-fluoro-N-[(Z)-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9235662 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-fluoro-N-[(Z)-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccccc2F)c(C)n1Cc1ccco1 |
| InChI | InChI=1S/C19H18FN3O2/c1-13-10-15(14(2)23(13)12-16-6-5-9-25-16)11-21-22-19(24)17-7-3-4-8-18(17)20/h3-11H,12H2,1-2H3,(H,22,24)/b21-11- |
| InChIKey | NSWDAFPDQKSMDW-NHDPSOOVSA-N |
| XLogP | 3.65 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|