C15H21BrN4OS — CID 9236248
3-(3-bromophenyl)-1-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiourea (PubChem CID 9236248) has the molecular formula C15H21BrN4OS and a molecular weight of 385.33 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiourea.
| Compound Name | 3-(3-bromophenyl)-1-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiourea |
|---|---|
| PubChem CID | 9236248 |
| Molecular Formula | C15H21BrN4OS |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 3-(3-bromophenyl)-1-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]thiourea |
| SMILES | CN1CCN(C(=O)CN(C)C(=S)Nc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H21BrN4OS/c1-18-6-8-20(9-7-18)14(21)11-19(2)15(22)17-13-5-3-4-12(16)10-13/h3-5,10H,6-9,11H2,1-2H3,(H,17,22) |
| InChIKey | BMEOAZFDIQOAGV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|