C15H12BrN3OS — CID 9247862
3-(4-bromophenyl)-N-(thiophen-2-ylmethyl)-1H-pyrazole-5-carboxamide (PubChem CID 9247862) has the molecular formula C15H12BrN3OS and a molecular weight of 362.25 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(thiophen-2-ylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-(thiophen-2-ylmethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 9247862 |
| Molecular Formula | C15H12BrN3OS |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 3-(4-bromophenyl)-N-(thiophen-2-ylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cc(-c2ccc(Br)cc2)n[nH]1 |
| InChI | InChI=1S/C15H12BrN3OS/c16-11-5-3-10(4-6-11)13-8-14(19-18-13)15(20)17-9-12-2-1-7-21-12/h1-8H,9H2,(H,17,20)(H,18,19) |
| InChIKey | XSXJBSRNZFXOEU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |