C19H31N4O3+ — CID 9249446
(2R)-N-(tert-butylcarbamoyl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9249446) has the molecular formula C19H31N4O3+ and a molecular weight of 363.48 g/mol. Its IUPAC name is (2R)-N-(tert-butylcarbamoyl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(tert-butylcarbamoyl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9249446 |
| Molecular Formula | C19H31N4O3+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (2R)-N-(tert-butylcarbamoyl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1ccccc1N1CC[NH+]([C@H](C)C(=O)NC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H30N4O3/c1-14(17(24)20-18(25)21-19(2,3)4)22-10-12-23(13-11-22)15-8-6-7-9-16(15)26-5/h6-9,14H,10-13H2,1-5H3,(H2,20,21,24,25)/p+1/t14-/m1/s1 |
| InChIKey | FSYWSWSPWPUVNZ-CQSZACIVSA-O |
| XLogP | 0.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |