C22H30N3O2+ — CID 8004755
(2R)-N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylpropanamide (PubChem CID 8004755) has the molecular formula C22H30N3O2+ and a molecular weight of 368.50 g/mol. Its IUPAC name is (2R)-N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylpropanamide.
| Compound Name | (2R)-N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 8004755 |
| Molecular Formula | C22H30N3O2+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (2R)-N-benzyl-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylpropanamide |
| SMILES | COc1ccccc1N1CC[NH+]([C@H](C)C(=O)N(C)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O2/c1-18(22(26)23(2)17-19-9-5-4-6-10-19)24-13-15-25(16-14-24)20-11-7-8-12-21(20)27-3/h4-12,18H,13-17H2,1-3H3/p+1/t18-/m1/s1 |
| InChIKey | HJWFPZQCXVYUGJ-GOSISDBHSA-O |
| XLogP | 1.45 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |