C26H36N3O2+ — CID 9249428
(2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one (PubChem CID 9249428) has the molecular formula C26H36N3O2+ and a molecular weight of 422.59 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one |
|---|---|
| PubChem CID | 9249428 |
| Molecular Formula | C26H36N3O2+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | (2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one |
| SMILES | COc1ccccc1N1CC[NH+]([C@@H](C)C(=O)N2CCC(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-21(27-16-18-28(19-17-27)24-10-6-7-11-25(24)31-2)26(30)29-14-12-23(13-15-29)20-22-8-4-3-5-9-22/h3-11,21,23H,12-20H2,1-2H3/p+1/t21-/m0/s1 |
| InChIKey | BPVDDSRYEOKZAD-NRFANRHFSA-O |
| XLogP | 2.27 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |