C13H20N2OS — CID 92500047
(2S)-N-(2-methylpropyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 92500047) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is (2S)-N-(2-methylpropyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(2-methylpropyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 92500047 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (2S)-N-(2-methylpropyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | CC(C)CNC(=O)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C13H20N2OS/c1-10(2)9-14-13(16)15-7-3-5-11(15)12-6-4-8-17-12/h4,6,8,10-11H,3,5,7,9H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | ODSOENXHSLUKLT-NSHDSACASA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |