C27H20FN3O5 — CID 92500846
(9S)-9-(3,4-dihydroxyphenyl)-17-(4-fluorophenyl)-12,14-dimethyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione (PubChem CID 92500846) has the molecular formula C27H20FN3O5 and a molecular weight of 485.47 g/mol. Its IUPAC name is (9S)-9-(3,4-dihydroxyphenyl)-17-(4-fluorophenyl)-12,14-dimethyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione.
| Compound Name | (9S)-9-(3,4-dihydroxyphenyl)-17-(4-fluorophenyl)-12,14-dimethyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
|---|---|
| PubChem CID | 92500846 |
| Molecular Formula | C27H20FN3O5 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (9S)-9-(3,4-dihydroxyphenyl)-17-(4-fluorophenyl)-12,14-dimethyl-8-oxa-1,12,14-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,16-pentaene-13,15-dione |
| SMILES | Cn1c(=O)c2c(-c3ccc(F)cc3)n3c(c2n(C)c1=O)[C@H](c1ccc(O)c(O)c1)Oc1ccccc1-3 |
| InChI | InChI=1S/C27H20FN3O5/c1-29-23-21(26(34)30(2)27(29)35)22(14-7-10-16(28)11-8-14)31-17-5-3-4-6-20(17)36-25(24(23)31)15-9-12-18(32)19(33)13-15/h3-13,25,32-33H,1-2H3/t25-/m0/s1 |
| InChIKey | COKSGVURJQHBBL-VWLOTQADSA-N |
| XLogP | 3.73 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|