C26H29N5O2 — CID 92505432
(2R)-2-[3,4-dimethyl-2-(4-methylphenyl)-7-oxopyrazolo[3,4-d]pyridazin-6-yl]-N-(3-phenylpropyl)propanamide (PubChem CID 92505432) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is (2R)-2-[3,4-dimethyl-2-(4-methylphenyl)-7-oxopyrazolo[3,4-d]pyridazin-6-yl]-N-(3-phenylpropyl)propanamide.
| Compound Name | (2R)-2-[3,4-dimethyl-2-(4-methylphenyl)-7-oxopyrazolo[3,4-d]pyridazin-6-yl]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 92505432 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2R)-2-[3,4-dimethyl-2-(4-methylphenyl)-7-oxopyrazolo[3,4-d]pyridazin-6-yl]-N-(3-phenylpropyl)propanamide |
| SMILES | Cc1ccc(-n2nc3c(=O)n([C@H](C)C(=O)NCCCc4ccccc4)nc(C)c3c2C)cc1 |
| InChI | InChI=1S/C26H29N5O2/c1-17-12-14-22(15-13-17)30-19(3)23-18(2)28-31(26(33)24(23)29-30)20(4)25(32)27-16-8-11-21-9-6-5-7-10-21/h5-7,9-10,12-15,20H,8,11,16H2,1-4H3,(H,27,32)/t20-/m1/s1 |
| InChIKey | KANSFAOYPRSGAV-HXUWFJFHSA-N |
| XLogP | 3.82 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|