C26H36N6O2 — CID 92691421
(2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-2-(3,4-dimethyl-7-oxo-2-phenylpyrazolo[3,4-d]pyridazin-6-yl)propanamide (PubChem CID 92691421) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is (2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-2-(3,4-dimethyl-7-oxo-2-phenylpyrazolo[3,4-d]pyridazin-6-yl)propanamide.
| Compound Name | (2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-2-(3,4-dimethyl-7-oxo-2-phenylpyrazolo[3,4-d]pyridazin-6-yl)propanamide |
|---|---|
| PubChem CID | 92691421 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-2-(3,4-dimethyl-7-oxo-2-phenylpyrazolo[3,4-d]pyridazin-6-yl)propanamide |
| SMILES | Cc1nn([C@H](C)C(=O)NCCCN(C)C2CCCCC2)c(=O)c2nn(-c3ccccc3)c(C)c12 |
| InChI | InChI=1S/C26H36N6O2/c1-18-23-19(2)31(22-14-9-6-10-15-22)29-24(23)26(34)32(28-18)20(3)25(33)27-16-11-17-30(4)21-12-7-5-8-13-21/h6,9-10,14-15,20-21H,5,7-8,11-13,16-17H2,1-4H3,(H,27,33)/t20-/m1/s1 |
| InChIKey | ZGYUQBJXXQKMHA-HXUWFJFHSA-N |
| XLogP | 3.53 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|