C32H23FN2O3 — CID 92507430
(2'R,3R,3'S,12'aS)-3'-acetyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,12a-dihydro-2H-naphtho[2,1-e]indolizine]-2-one (PubChem CID 92507430) has the molecular formula C32H23FN2O3 and a molecular weight of 502.55 g/mol. Its IUPAC name is (2'R,3R,3'S,12'aS)-3'-acetyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,12a-dihydro-2H-naphtho[2,1-e]indolizine]-2-one.
| Compound Name | (2'R,3R,3'S,12'aS)-3'-acetyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,12a-dihydro-2H-naphtho[2,1-e]indolizine]-2-one |
|---|---|
| PubChem CID | 92507430 |
| Molecular Formula | C32H23FN2O3 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (2'R,3R,3'S,12'aS)-3'-acetyl-2'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,12a-dihydro-2H-naphtho[2,1-e]indolizine]-2-one |
| SMILES | CC(=O)[C@@H]1[C@H](C(=O)c2ccc(F)cc2)[C@]2(C(=O)Nc3ccccc32)[C@@H]2C=Cc3c(ccc4ccccc34)N12 |
| InChI | InChI=1S/C32H23FN2O3/c1-18(36)29-28(30(37)20-10-13-21(33)14-11-20)32(24-8-4-5-9-25(24)34-31(32)38)27-17-15-23-22-7-3-2-6-19(22)12-16-26(23)35(27)29/h2-17,27-29H,1H3,(H,34,38)/t27-,28+,29+,32+/m0/s1 |
| InChIKey | PYVLFAANCGCNQE-FQNXFSSYSA-N |
| XLogP | 5.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |