C21H22N6 — CID 92512556
4-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 92512556) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 4-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 92512556 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-[(3R)-3-methyl-4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | Cc1ccc(N2CCN(c3nc4ccccc4n4cnnc34)C[C@H]2C)cc1 |
| InChI | InChI=1S/C21H22N6/c1-15-7-9-17(10-8-15)26-12-11-25(13-16(26)2)20-21-24-22-14-27(21)19-6-4-3-5-18(19)23-20/h3-10,14,16H,11-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | VCPSNWLIJMGMJB-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|