C12H13N3O3 — CID 92529178
(1S,7R)-7-methoxy-4-methyl-2,4,6-triazatricyclo[6.5.0.02,6]trideca-8,10,12-triene-3,5-dione (PubChem CID 92529178) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is (1S,7R)-7-methoxy-4-methyl-2,4,6-triazatricyclo[6.5.0.02,6]trideca-8,10,12-triene-3,5-dione.
| Compound Name | (1S,7R)-7-methoxy-4-methyl-2,4,6-triazatricyclo[6.5.0.02,6]trideca-8,10,12-triene-3,5-dione |
|---|---|
| PubChem CID | 92529178 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (1S,7R)-7-methoxy-4-methyl-2,4,6-triazatricyclo[6.5.0.02,6]trideca-8,10,12-triene-3,5-dione |
| SMILES | CO[C@@H]1C2=CC=CC=C[C@@H]2n2c(=O)n(C)c(=O)n21 |
| InChI | InChI=1S/C12H13N3O3/c1-13-11(16)14-9-7-5-3-4-6-8(9)10(18-2)15(14)12(13)17/h3-7,9-10H,1-2H3/t9-,10+/m0/s1 |
| InChIKey | AEQICPKHNKNGSO-VHSXEESVSA-N |
| XLogP | 0.10 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |