C15H13N3O2 — CID 12679364
(1R,11R)-14-methyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione (PubChem CID 12679364) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is (1R,11R)-14-methyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione.
| Compound Name | (1R,11R)-14-methyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione |
|---|---|
| PubChem CID | 12679364 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (1R,11R)-14-methyl-12,14,16-triazatetracyclo[9.5.1.06,17.012,16]heptadeca-2,4,6(17),7,9-pentaene-13,15-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1C=CC=CC3=C1[C@H]2C=CC=C3 |
| InChI | InChI=1S/C15H13N3O2/c1-16-14(19)17-11-8-4-2-6-10-7-3-5-9-12(13(10)11)18(17)15(16)20/h2-9,11-12H,1H3/t11-,12-/m1/s1 |
| InChIKey | MJXCPQWFYXJXSF-VXGBXAGGSA-N |
| XLogP | 0.99 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |