C10H13N3O2 — CID 15203504
4-propyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 15203504) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-propyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-propyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 15203504 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-propyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCCn1c(=O)n2n(c1=O)C1C=CC2C1 |
| InChI | InChI=1S/C10H13N3O2/c1-2-5-11-9(14)12-7-3-4-8(6-7)13(12)10(11)15/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | NSYSRUSLYZUOGA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|