C22H19BrNO4P — CID 92535132
(2R,4E)-4-(4-bromophenyl)-2-diphenylphosphoryl-4-hydroxyiminobutanoic acid (PubChem CID 92535132) has the molecular formula C22H19BrNO4P and a molecular weight of 472.28 g/mol. Its IUPAC name is (2R,4E)-4-(4-bromophenyl)-2-diphenylphosphoryl-4-hydroxyiminobutanoic acid.
| Compound Name | (2R,4E)-4-(4-bromophenyl)-2-diphenylphosphoryl-4-hydroxyiminobutanoic acid |
|---|---|
| PubChem CID | 92535132 |
| Molecular Formula | C22H19BrNO4P |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | (2R,4E)-4-(4-bromophenyl)-2-diphenylphosphoryl-4-hydroxyiminobutanoic acid |
| SMILES | O=C(O)[C@@H](C/C(=N\O)c1ccc(Br)cc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19BrNO4P/c23-17-13-11-16(12-14-17)20(24-27)15-21(22(25)26)29(28,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,21,27H,15H2,(H,25,26)/b24-20+/t21-/m1/s1 |
| InChIKey | SKBZEYHSERXYRB-KWLPWJRRSA-N |
| XLogP | 4.48 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|