C11H22O2 — CID 92538664
cis-(2S,6R)-2,6-dimethyl-4-propoxycyclohexan-1-ol (PubChem CID 92538664) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is cis-(2S,6R)-2,6-dimethyl-4-propoxycyclohexan-1-ol.
| Compound Name | cis-(2S,6R)-2,6-dimethyl-4-propoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 92538664 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | cis-(2S,6R)-2,6-dimethyl-4-propoxycyclohexan-1-ol |
| SMILES | CCCOC1C[C@@H](C)C(O)[C@@H](C)C1 |
| InChI | InChI=1S/C11H22O2/c1-4-5-13-10-6-8(2)11(12)9(3)7-10/h8-12H,4-7H2,1-3H3/t8-,9+,10?,11? |
| InChIKey | ZSBSCRJAILDMEV-IXBNRNDTSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |