C12H24O3 — CID 164538174
(2S,4R,6S)-2-methyl-6-propan-2-yloxy-4-propoxyoxane (PubChem CID 164538174) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2S,4R,6S)-2-methyl-6-propan-2-yloxy-4-propoxyoxane.
| Compound Name | (2S,4R,6S)-2-methyl-6-propan-2-yloxy-4-propoxyoxane |
|---|---|
| PubChem CID | 164538174 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (2S,4R,6S)-2-methyl-6-propan-2-yloxy-4-propoxyoxane |
| SMILES | CCCO[C@H]1C[C@@H](OC(C)C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H24O3/c1-5-6-13-11-7-10(4)15-12(8-11)14-9(2)3/h9-12H,5-8H2,1-4H3/t10-,11+,12-/m0/s1 |
| InChIKey | QNRQWCRKCHNZRI-TUAOUCFPSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |