C7H14O3 — CID 88804523
4-methyl-2-propoxy-1,3-dioxolane (PubChem CID 88804523) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-methyl-2-propoxy-1,3-dioxolane.
| Compound Name | 4-methyl-2-propoxy-1,3-dioxolane |
|---|---|
| PubChem CID | 88804523 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 4-methyl-2-propoxy-1,3-dioxolane |
| SMILES | CCCOC1OCC(C)O1 |
| InChI | InChI=1S/C7H14O3/c1-3-4-8-7-9-5-6(2)10-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | JOJJHZWLYQPYDX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |