C26H28N4O — CID 92548354
(6S)-4-prop-2-enyl-1-(pyridin-4-ylmethyl)-6-[(4-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 92548354) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is (6S)-4-prop-2-enyl-1-(pyridin-4-ylmethyl)-6-[(4-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | (6S)-4-prop-2-enyl-1-(pyridin-4-ylmethyl)-6-[(4-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92548354 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (6S)-4-prop-2-enyl-1-(pyridin-4-ylmethyl)-6-[(4-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(Cc2ccncc2)C[C@H](Cc2ccc(-c3cccnc3)cc2)C1=O |
| InChI | InChI=1S/C26H28N4O/c1-2-14-30-16-15-29(19-22-9-12-27-13-10-22)20-25(26(30)31)17-21-5-7-23(8-6-21)24-4-3-11-28-18-24/h2-13,18,25H,1,14-17,19-20H2/t25-/m0/s1 |
| InChIKey | MZVHLWAXRDSOEV-VWLOTQADSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|