C26H28N4O — CID 124993968
(3S)-4-[(6-methyl-2-pyridinyl)methyl]-1-prop-2-enyl-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one (PubChem CID 124993968) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is (3S)-4-[(6-methyl-2-pyridinyl)methyl]-1-prop-2-enyl-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one.
| Compound Name | (3S)-4-[(6-methyl-2-pyridinyl)methyl]-1-prop-2-enyl-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 124993968 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (3S)-4-[(6-methyl-2-pyridinyl)methyl]-1-prop-2-enyl-3-[(4-pyridin-3-ylphenyl)methyl]piperazin-2-one |
| SMILES | C=CCN1CCN(Cc2cccc(C)n2)[C@@H](Cc2ccc(-c3cccnc3)cc2)C1=O |
| InChI | InChI=1S/C26H28N4O/c1-3-14-29-15-16-30(19-24-8-4-6-20(2)28-24)25(26(29)31)17-21-9-11-22(12-10-21)23-7-5-13-27-18-23/h3-13,18,25H,1,14-17,19H2,2H3/t25-/m0/s1 |
| InChIKey | QBNSWWGBYRFIPN-VWLOTQADSA-N |
| XLogP | 3.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|