C24H25N5O3 — CID 92550770
[4-[[(3R)-3-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate (PubChem CID 92550770) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is [4-[[(3R)-3-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate.
| Compound Name | [4-[[(3R)-3-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 92550770 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | [4-[[(3R)-3-[7-amino-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CN2CCC[C@@H](c3cc(N)n4nc(-c5ccco5)cc4n3)C2)cc1 |
| InChI | InChI=1S/C24H25N5O3/c1-16(30)32-19-8-6-17(7-9-19)14-28-10-2-4-18(15-28)20-12-23(25)29-24(26-20)13-21(27-29)22-5-3-11-31-22/h3,5-9,11-13,18H,2,4,10,14-15,25H2,1H3/t18-/m1/s1 |
| InChIKey | TXBFYCSYVOZTJO-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|