C22H23F3N4O2 — CID 95801736
[4-[[(3R)-3-[2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate (PubChem CID 95801736) has the molecular formula C22H23F3N4O2 and a molecular weight of 432.45 g/mol. Its IUPAC name is [4-[[(3R)-3-[2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate.
| Compound Name | [4-[[(3R)-3-[2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 95801736 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [4-[[(3R)-3-[2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CN2CCC[C@@H](c3cc(C(F)(F)F)n4nc(C)cc4n3)C2)cc1 |
| InChI | InChI=1S/C22H23F3N4O2/c1-14-10-21-26-19(11-20(22(23,24)25)29(21)27-14)17-4-3-9-28(13-17)12-16-5-7-18(8-6-16)31-15(2)30/h5-8,10-11,17H,3-4,9,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | PYAOHIZCGSZWLI-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|