C22H26FN3O — CID 92561629
1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-[(6-methyl-2-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone (PubChem CID 92561629) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-[(6-methyl-2-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone.
| Compound Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-[(6-methyl-2-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone |
|---|---|
| PubChem CID | 92561629 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-[(6-methyl-2-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]2[C@H]1[C@@H](c1ccc(F)cc1)CN2Cc1cccc(C)n1 |
| InChI | InChI=1S/C22H26FN3O/c1-15-5-3-6-19(24-15)13-25-14-20(17-8-10-18(23)11-9-17)22-21(25)7-4-12-26(22)16(2)27/h3,5-6,8-11,20-22H,4,7,12-14H2,1-2H3/t20-,21-,22-/m1/s1 |
| InChIKey | DZAOSZIEWRNXOZ-YPAWHYETSA-N |
| XLogP | 3.51 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |