C26H33N3O — CID 92561790
N-[(R)-[(3R)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methylbenzamide (PubChem CID 92561790) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[(R)-[(3R)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methylbenzamide.
| Compound Name | N-[(R)-[(3R)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 92561790 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | N-[(R)-[(3R)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-3-yl]-pyridin-2-ylmethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N[C@@H](c1ccccn1)[C@@H]1CCCN(C[C@H]2CC=CCC2)C1 |
| InChI | InChI=1S/C26H33N3O/c1-20-10-5-6-14-23(20)26(30)28-25(24-15-7-8-16-27-24)22-13-9-17-29(19-22)18-21-11-3-2-4-12-21/h2-3,5-8,10,14-16,21-22,25H,4,9,11-13,17-19H2,1H3,(H,28,30)/t21-,22+,25+/m0/s1 |
| InChIKey | XOXJGZHJMGRMII-SGIRGMQISA-N |
| XLogP | 4.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|