C21H27FN4O — CID 92562781
1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-3-(5-methylpyrazol-1-yl)propan-1-one (PubChem CID 92562781) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-3-(5-methylpyrazol-1-yl)propan-1-one.
| Compound Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-3-(5-methylpyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 92562781 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-3-(5-methylpyrazol-1-yl)propan-1-one |
| SMILES | Cc1ccnn1CCC(=O)N1C[C@H](c2ccc(F)cc2)[C@@H]2[C@H]1CCCN2C |
| InChI | InChI=1S/C21H27FN4O/c1-15-9-11-23-26(15)13-10-20(27)25-14-18(16-5-7-17(22)8-6-16)21-19(25)4-3-12-24(21)2/h5-9,11,18-19,21H,3-4,10,12-14H2,1-2H3/t18-,19-,21-/m1/s1 |
| InChIKey | ATZADBQFCKDMGJ-SFHLNBCPSA-N |
| XLogP | 2.81 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |