C21H30N4O — CID 92565798
4-[(2-methylimidazol-1-yl)methyl]-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-ol (PubChem CID 92565798) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-[(2-methylimidazol-1-yl)methyl]-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-ol.
| Compound Name | 4-[(2-methylimidazol-1-yl)methyl]-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 92565798 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-[(2-methylimidazol-1-yl)methyl]-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-ol |
| SMILES | Cc1nccn1CC1(O)CCN(Cc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H30N4O/c1-18-22-10-15-25(18)17-21(26)8-13-23(14-9-21)16-19-4-6-20(7-5-19)24-11-2-3-12-24/h4-7,10,15,26H,2-3,8-9,11-14,16-17H2,1H3 |
| InChIKey | HRAGXZOHSIUQET-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|