C25H28FN5O — CID 92568767
N-(3-fluorophenyl)-2-[(2R)-1-(oxan-4-yl)piperidin-2-yl]-6-pyridin-3-ylpyrimidin-4-amine (PubChem CID 92568767) has the molecular formula C25H28FN5O and a molecular weight of 433.53 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(2R)-1-(oxan-4-yl)piperidin-2-yl]-6-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | N-(3-fluorophenyl)-2-[(2R)-1-(oxan-4-yl)piperidin-2-yl]-6-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 92568767 |
| Molecular Formula | C25H28FN5O |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(2R)-1-(oxan-4-yl)piperidin-2-yl]-6-pyridin-3-ylpyrimidin-4-amine |
| SMILES | Fc1cccc(Nc2cc(-c3cccnc3)nc([C@H]3CCCCN3C3CCOCC3)n2)c1 |
| InChI | InChI=1S/C25H28FN5O/c26-19-6-3-7-20(15-19)28-24-16-22(18-5-4-11-27-17-18)29-25(30-24)23-8-1-2-12-31(23)21-9-13-32-14-10-21/h3-7,11,15-17,21,23H,1-2,8-10,12-14H2,(H,28,29,30)/t23-/m1/s1 |
| InChIKey | GGTHTNFTQHJAJC-HSZRJFAPSA-N |
| XLogP | 5.13 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |