C24H25N5O — CID 110240191
[2-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)pyrrolidin-1-yl]-cyclobutylmethanone (PubChem CID 110240191) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is [2-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)pyrrolidin-1-yl]-cyclobutylmethanone.
| Compound Name | [2-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)pyrrolidin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 110240191 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | [2-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)pyrrolidin-1-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCCC1c1nc(Nc2ccccc2)cc(-c2cccnc2)n1 |
| InChI | InChI=1S/C24H25N5O/c30-24(17-7-4-8-17)29-14-6-12-21(29)23-27-20(18-9-5-13-25-16-18)15-22(28-23)26-19-10-2-1-3-11-19/h1-3,5,9-11,13,15-17,21H,4,6-8,12,14H2,(H,26,27,28) |
| InChIKey | PIVIVKGHOYPGNM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |