C26H27N5O — CID 92575173
[(2R)-2-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)pyrrolidin-1-yl]-[(1R)-cyclohex-3-en-1-yl]methanone (PubChem CID 92575173) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is [(2R)-2-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)pyrrolidin-1-yl]-[(1R)-cyclohex-3-en-1-yl]methanone.
| Compound Name | [(2R)-2-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)pyrrolidin-1-yl]-[(1R)-cyclohex-3-en-1-yl]methanone |
|---|---|
| PubChem CID | 92575173 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [(2R)-2-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)pyrrolidin-1-yl]-[(1R)-cyclohex-3-en-1-yl]methanone |
| SMILES | O=C([C@H]1CC=CCC1)N1CCC[C@@H]1c1nc(Nc2ccccc2)cc(-c2ccncc2)n1 |
| InChI | InChI=1S/C26H27N5O/c32-26(20-8-3-1-4-9-20)31-17-7-12-23(31)25-29-22(19-13-15-27-16-14-19)18-24(30-25)28-21-10-5-2-6-11-21/h1-3,5-6,10-11,13-16,18,20,23H,4,7-9,12,17H2,(H,28,29,30)/t20-,23+/m0/s1 |
| InChIKey | CXEBMIILEYDRIX-NZQKXSOJSA-N |
| XLogP | 5.30 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|