C27H29N5O — CID 92575268
[4-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-[(1S)-cyclohex-3-en-1-yl]methanone (PubChem CID 92575268) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is [4-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-[(1S)-cyclohex-3-en-1-yl]methanone.
| Compound Name | [4-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-[(1S)-cyclohex-3-en-1-yl]methanone |
|---|---|
| PubChem CID | 92575268 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [4-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-[(1S)-cyclohex-3-en-1-yl]methanone |
| SMILES | O=C([C@@H]1CC=CCC1)N1CCC(c2nc(Nc3ccccc3)cc(-c3ccncc3)n2)CC1 |
| InChI | InChI=1S/C27H29N5O/c33-27(22-7-3-1-4-8-22)32-17-13-21(14-18-32)26-30-24(20-11-15-28-16-12-20)19-25(31-26)29-23-9-5-2-6-10-23/h1-3,5-6,9-12,15-16,19,21-22H,4,7-8,13-14,17-18H2,(H,29,30,31)/t22-/m1/s1 |
| InChIKey | SUJFOHVQZLRLHB-JOCHJYFZSA-N |
| XLogP | 5.34 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|