C25H27N5O — CID 92575090
[(3S)-3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-cyclobutylmethanone (PubChem CID 92575090) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is [(3S)-3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-cyclobutylmethanone.
| Compound Name | [(3S)-3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 92575090 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [(3S)-3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCC[C@H](c2nc(Nc3ccccc3)cc(-c3ccncc3)n2)C1 |
| InChI | InChI=1S/C25H27N5O/c31-25(19-6-4-7-19)30-15-5-8-20(17-30)24-28-22(18-11-13-26-14-12-18)16-23(29-24)27-21-9-2-1-3-10-21/h1-3,9-14,16,19-20H,4-8,15,17H2,(H,27,28,29)/t20-/m0/s1 |
| InChIKey | OHXACVUSOLODTP-FQEVSTJZSA-N |
| XLogP | 4.79 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |