C26H24N6O — CID 110240084
[3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 110240084) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol. Its IUPAC name is [3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110240084 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [3-(4-anilino-6-pyridin-4-ylpyrimidin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCC(c2nc(Nc3ccccc3)cc(-c3ccncc3)n2)C1 |
| InChI | InChI=1S/C26H24N6O/c33-26(20-6-4-12-28-17-20)32-15-5-7-21(18-32)25-30-23(19-10-13-27-14-11-19)16-24(31-25)29-22-8-2-1-3-9-22/h1-4,6,8-14,16-17,21H,5,7,15,18H2,(H,29,30,31) |
| InChIKey | XLGYZFZUGONWIP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |