C26H29N5O — CID 110240107
[3-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)piperidin-1-yl]-cyclopentylmethanone (PubChem CID 110240107) has the molecular formula C26H29N5O and a molecular weight of 427.55 g/mol. Its IUPAC name is [3-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)piperidin-1-yl]-cyclopentylmethanone.
| Compound Name | [3-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)piperidin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 110240107 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [3-(4-anilino-6-pyridin-3-ylpyrimidin-2-yl)piperidin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCCC(c2nc(Nc3ccccc3)cc(-c3cccnc3)n2)C1 |
| InChI | InChI=1S/C26H29N5O/c32-26(19-8-4-5-9-19)31-15-7-11-21(18-31)25-29-23(20-10-6-14-27-17-20)16-24(30-25)28-22-12-2-1-3-13-22/h1-3,6,10,12-14,16-17,19,21H,4-5,7-9,11,15,18H2,(H,28,29,30) |
| InChIKey | SCOMEICGUWSSHC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |