C25H27FN2 — CID 92569255
(2R)-1-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3-[(3-methylphenyl)methyl]imidazolidine (PubChem CID 92569255) has the molecular formula C25H27FN2 and a molecular weight of 374.50 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3-[(3-methylphenyl)methyl]imidazolidine.
| Compound Name | (2R)-1-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3-[(3-methylphenyl)methyl]imidazolidine |
|---|---|
| PubChem CID | 92569255 |
| Molecular Formula | C25H27FN2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)-3-[(3-methylphenyl)methyl]imidazolidine |
| SMILES | Cc1ccc([C@@H]2N(Cc3cccc(C)c3)CCN2Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H27FN2/c1-19-10-12-22(13-11-19)25-27(17-21-7-5-6-20(2)16-21)14-15-28(25)18-23-8-3-4-9-24(23)26/h3-13,16,25H,14-15,17-18H2,1-2H3/t25-/m1/s1 |
| InChIKey | ADJLPLVYGIMMFX-RUZDIDTESA-N |
| XLogP | 5.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |