C30H37FN2O2 — CID 92569447
(2S)-2-(4-butoxy-3-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-3-[(4-methylphenyl)methyl]imidazolidine (PubChem CID 92569447) has the molecular formula C30H37FN2O2 and a molecular weight of 476.64 g/mol. Its IUPAC name is (2S)-2-(4-butoxy-3-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-3-[(4-methylphenyl)methyl]imidazolidine.
| Compound Name | (2S)-2-(4-butoxy-3-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-3-[(4-methylphenyl)methyl]imidazolidine |
|---|---|
| PubChem CID | 92569447 |
| Molecular Formula | C30H37FN2O2 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (2S)-2-(4-butoxy-3-ethoxyphenyl)-1-[(2-fluorophenyl)methyl]-3-[(4-methylphenyl)methyl]imidazolidine |
| SMILES | CCCCOc1ccc([C@H]2N(Cc3ccc(C)cc3)CCN2Cc2ccccc2F)cc1OCC |
| InChI | InChI=1S/C30H37FN2O2/c1-4-6-19-35-28-16-15-25(20-29(28)34-5-2)30-32(21-24-13-11-23(3)12-14-24)17-18-33(30)22-26-9-7-8-10-27(26)31/h7-16,20,30H,4-6,17-19,21-22H2,1-3H3/t30-/m0/s1 |
| InChIKey | IVPHIPLEVCMERP-PMERELPUSA-N |
| XLogP | 6.73 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|