C23H27ClN2O3 — CID 92571892
3-[(3R)-1-(adamantane-1-carbonyl)piperidin-3-yl]-5-chloro-1,3-benzoxazol-2-one (PubChem CID 92571892) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 3-[(3R)-1-(adamantane-1-carbonyl)piperidin-3-yl]-5-chloro-1,3-benzoxazol-2-one.
| Compound Name | 3-[(3R)-1-(adamantane-1-carbonyl)piperidin-3-yl]-5-chloro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 92571892 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-[(3R)-1-(adamantane-1-carbonyl)piperidin-3-yl]-5-chloro-1,3-benzoxazol-2-one |
| SMILES | O=C(N1CCC[C@@H](n2c(=O)oc3ccc(Cl)cc32)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27ClN2O3/c24-17-3-4-20-19(9-17)26(22(28)29-20)18-2-1-5-25(13-18)21(27)23-10-14-6-15(11-23)8-16(7-14)12-23/h3-4,9,14-16,18H,1-2,5-8,10-13H2/t14?,15?,16?,18-,23?/m1/s1 |
| InChIKey | WALAHCADDFMUTC-FBXSJCODSA-N |
| XLogP | 4.63 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |