C19H15F3N2O3 — CID 46081499
3-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-5-fluoro-1,3-benzoxazol-2-one (PubChem CID 46081499) has the molecular formula C19H15F3N2O3 and a molecular weight of 376.33 g/mol. Its IUPAC name is 3-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-5-fluoro-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-5-fluoro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 46081499 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-[1-(3,4-difluorobenzoyl)piperidin-4-yl]-5-fluoro-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCC(n2c(=O)oc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C19H15F3N2O3/c20-12-2-4-17-16(10-12)24(19(26)27-17)13-5-7-23(8-6-13)18(25)11-1-3-14(21)15(22)9-11/h1-4,9-10,13H,5-8H2 |
| InChIKey | VVILFOZBCICMGA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |