C22H24ClN3O3 — CID 46085813
5-tert-butyl-3-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 46085813) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 5-tert-butyl-3-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]-1,3-benzoxazol-2-one.
| Compound Name | 5-tert-butyl-3-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 46085813 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 5-tert-butyl-3-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | CC(C)(C)c1ccc2oc(=O)n(C3CCN(C(=O)c4ccnc(Cl)c4)CC3)c2c1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-22(2,3)15-4-5-18-17(13-15)26(21(28)29-18)16-7-10-25(11-8-16)20(27)14-6-9-24-19(23)12-14/h4-6,9,12-13,16H,7-8,10-11H2,1-3H3 |
| InChIKey | POALIVXLJUGRDB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|