C21H18FN5OS — CID 92572524
2-(2-fluorophenyl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide (PubChem CID 92572524) has the molecular formula C21H18FN5OS and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 92572524 |
| Molecular Formula | C21H18FN5OS |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide |
| SMILES | O=C(Cc1ccccc1F)NCCn1ncc(-c2cnccn2)c1-c1cccs1 |
| InChI | InChI=1S/C21H18FN5OS/c22-17-5-2-1-4-15(17)12-20(28)25-9-10-27-21(19-6-3-11-29-19)16(13-26-27)18-14-23-7-8-24-18/h1-8,11,13-14H,9-10,12H2,(H,25,28) |
| InChIKey | WSXISRXTWUWKIC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |